C8H16N2O2S — CID 86749247
(2S)-1-[(2R)-2-amino-3-sulfanylpropyl]pyrrolidine-2-carboxylic acid (PubChem CID 86749247) has the molecular formula C8H16N2O2S and a molecular weight of 204.29 g/mol. Its IUPAC name is (2S)-1-[(2R)-2-amino-3-sulfanylpropyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-[(2R)-2-amino-3-sulfanylpropyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 86749247 |
| Molecular Formula | C8H16N2O2S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.09 |
| IUPAC Name | (2S)-1-[(2R)-2-amino-3-sulfanylpropyl]pyrrolidine-2-carboxylic acid |
| SMILES | N[C@@H](CS)CN1CCC[C@H]1C(=O)O |
| InChI | InChI=1S/C8H16N2O2S/c9-6(5-13)4-10-3-1-2-7(10)8(11)12/h6-7,13H,1-5,9H2,(H,11,12)/t6-,7+/m1/s1 |
| InChIKey | LECGRUWOPVGZET-RQJHMYQMSA-N |
| XLogP | -0.21 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|