C19H23ClFNO2 — CID 86749359
(8R,9S,10S,13S,14S)-4-amino-2-fluoro-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione;hydrochloride (PubChem CID 86749359) has the molecular formula C19H23ClFNO2 and a molecular weight of 351.85 g/mol. Its IUPAC name is (8R,9S,10S,13S,14S)-4-amino-2-fluoro-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione;hydrochloride.
| Compound Name | (8R,9S,10S,13S,14S)-4-amino-2-fluoro-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione;hydrochloride |
|---|---|
| PubChem CID | 86749359 |
| Molecular Formula | C19H23ClFNO2 |
| Molecular Weight | 351.85 g/mol |
| Exact Mass | 351.14 |
| IUPAC Name | (8R,9S,10S,13S,14S)-4-amino-2-fluoro-10,13-dimethyl-9,11,12,14,15,16-hexahydro-8H-cyclopenta[a]phenanthrene-3,17-dione;hydrochloride |
| SMILES | C[C@]12C=C(F)C(=O)C(N)=C1C=C[C@@H]1[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]12.Cl |
| InChI | InChI=1S/C19H22FNO2.ClH/c1-18-8-7-12-10(11(18)5-6-15(18)22)3-4-13-16(21)17(23)14(20)9-19(12,13)2;/h3-4,9-12H,5-8,21H2,1-2H3;1H/t10-,11-,12-,18-,19+;/m0./s1 |
| InChIKey | BAXRDZLEYKTJNR-FZFZKCAVSA-N |
| XLogP | 3.64 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.85 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|