C26H40O3Si — CID 71477254
(8R,9S,10R,13S,14S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione (PubChem CID 71477254) has the molecular formula C26H40O3Si and a molecular weight of 428.69 g/mol. Its IUPAC name is (8R,9S,10R,13S,14S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione.
| Compound Name | (8R,9S,10R,13S,14S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
|---|---|
| PubChem CID | 71477254 |
| Molecular Formula | C26H40O3Si |
| Molecular Weight | 428.69 g/mol |
| Exact Mass | 428.27 |
| IUPAC Name | (8R,9S,10R,13S,14S)-4-[[tert-butyl(dimethyl)silyl]oxymethyl]-10,13-dimethyl-2,8,9,11,12,14,15,16-octahydro-1H-cyclopenta[a]phenanthrene-3,17-dione |
| SMILES | CC(C)(C)[Si](C)(C)OCC1=C2C=C[C@@H]3[C@H](CC[C@]4(C)C(=O)CC[C@@H]34)[C@@]2(C)CCC1=O |
| InChI | InChI=1S/C26H40O3Si/c1-24(2,3)30(6,7)29-16-18-20-9-8-17-19-10-11-23(28)26(19,5)14-12-21(17)25(20,4)15-13-22(18)27/h8-9,17,19,21H,10-16H2,1-7H3/t17-,19-,21-,25-,26-/m0/s1 |
| InChIKey | KRCAWXJKOILMRP-QDRGDOQRSA-N |
| XLogP | 6.26 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.69 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|