C25H38O4Si — CID 66713942
10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-1,2,4,5,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthrene-3,6,17-trione (PubChem CID 66713942) has the molecular formula C25H38O4Si and a molecular weight of 430.66 g/mol. Its IUPAC name is 10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-1,2,4,5,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthrene-3,6,17-trione.
| Compound Name | 10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-1,2,4,5,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthrene-3,6,17-trione |
|---|---|
| PubChem CID | 66713942 |
| Molecular Formula | C25H38O4Si |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.25 |
| IUPAC Name | 10-[[tert-butyl(dimethyl)silyl]oxymethyl]-13-methyl-1,2,4,5,7,8,9,11,12,14-decahydrocyclopenta[a]phenanthrene-3,6,17-trione |
| SMILES | CC12CCC3C(CC(=O)C4CC(=O)CCC43CO[Si](C)(C)C(C)(C)C)C1C=CC2=O |
| InChI | InChI=1S/C25H38O4Si/c1-23(2,3)30(5,6)29-15-25-12-9-16(26)13-20(25)21(27)14-17-18-7-8-22(28)24(18,4)11-10-19(17)25/h7-8,17-20H,9-15H2,1-6H3 |
| InChIKey | YAZTXXQREUFYPO-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|