C20H27NO2 — CID 77405243
8,10a,12a-trimethyl-3b,4,5,9,10,10b,11,12-octahydro-3aH-indeno[4,5-i][3]benzazepine-1,7-dione (PubChem CID 77405243) has the molecular formula C20H27NO2 and a molecular weight of 313.44 g/mol. Its IUPAC name is 8,10a,12a-trimethyl-3b,4,5,9,10,10b,11,12-octahydro-3aH-indeno[4,5-i][3]benzazepine-1,7-dione.
| Compound Name | 8,10a,12a-trimethyl-3b,4,5,9,10,10b,11,12-octahydro-3aH-indeno[4,5-i][3]benzazepine-1,7-dione |
|---|---|
| PubChem CID | 77405243 |
| Molecular Formula | C20H27NO2 |
| Molecular Weight | 313.44 g/mol |
| Exact Mass | 313.20 |
| IUPAC Name | 8,10a,12a-trimethyl-3b,4,5,9,10,10b,11,12-octahydro-3aH-indeno[4,5-i][3]benzazepine-1,7-dione |
| SMILES | CN1CCC2(C)C(=CC1=O)CCC1C3C=CC(=O)C3(C)CCC12 |
| InChI | InChI=1S/C20H27NO2/c1-19-10-11-21(3)18(23)12-13(19)4-5-14-15-6-7-17(22)20(15,2)9-8-16(14)19/h6-7,12,14-16H,4-5,8-11H2,1-3H3 |
| InChIKey | LLJIILAURXPLGR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.44 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |