C25H41NO4Si — CID 24751524
methyl (1R,2R,9S,12R,16R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-12-methyl-5-oxo-10-azatetracyclo[7.6.1.02,7.012,16]hexadec-6-ene-10-carboxylate (PubChem CID 24751524) has the molecular formula C25H41NO4Si and a molecular weight of 447.69 g/mol. Its IUPAC name is methyl (1R,2R,9S,12R,16R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-12-methyl-5-oxo-10-azatetracyclo[7.6.1.02,7.012,16]hexadec-6-ene-10-carboxylate.
| Compound Name | methyl (1R,2R,9S,12R,16R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-12-methyl-5-oxo-10-azatetracyclo[7.6.1.02,7.012,16]hexadec-6-ene-10-carboxylate |
|---|---|
| PubChem CID | 24751524 |
| Molecular Formula | C25H41NO4Si |
| Molecular Weight | 447.69 g/mol |
| Exact Mass | 447.28 |
| IUPAC Name | methyl (1R,2R,9S,12R,16R)-1-[[tert-butyl(dimethyl)silyl]oxymethyl]-12-methyl-5-oxo-10-azatetracyclo[7.6.1.02,7.012,16]hexadec-6-ene-10-carboxylate |
| SMILES | COC(=O)N1C[C@]2(C)CCC[C@@]3(CO[Si](C)(C)C(C)(C)C)[C@@H]4CCC(=O)C=C4C[C@H]1[C@H]23 |
| InChI | InChI=1S/C25H41NO4Si/c1-23(2,3)31(6,7)30-16-25-12-8-11-24(4)15-26(22(28)29-5)20(21(24)25)14-17-13-18(27)9-10-19(17)25/h13,19-21H,8-12,14-16H2,1-7H3/t19-,20+,21-,24+,25-/m1/s1 |
| InChIKey | VHFIVHFILUYVRL-DCDJFBNSSA-N |
| XLogP | 5.56 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.69 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|