C24H20F3NO4 — CID 86754495
[2-[3-[[4-(trifluoromethyl)benzoyl]amino]propoxy]phenyl] benzoate (PubChem CID 86754495) has the molecular formula C24H20F3NO4 and a molecular weight of 443.42 g/mol. Its IUPAC name is [2-[3-[[4-(trifluoromethyl)benzoyl]amino]propoxy]phenyl] benzoate.
| Compound Name | [2-[3-[[4-(trifluoromethyl)benzoyl]amino]propoxy]phenyl] benzoate |
|---|---|
| PubChem CID | 86754495 |
| Molecular Formula | C24H20F3NO4 |
| Molecular Weight | 443.42 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | [2-[3-[[4-(trifluoromethyl)benzoyl]amino]propoxy]phenyl] benzoate |
| SMILES | O=C(NCCCOc1ccccc1OC(=O)c1ccccc1)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H20F3NO4/c25-24(26,27)19-13-11-17(12-14-19)22(29)28-15-6-16-31-20-9-4-5-10-21(20)32-23(30)18-7-2-1-3-8-18/h1-5,7-14H,6,15-16H2,(H,28,29) |
| InChIKey | XIKFQWSVUGSJME-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.42 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|