C17H16BrClF3NO2 — CID 86755964
(3S,5S)-3-(2-bromoethyl)-7-chloro-5-[(E)-2-cyclopropylethenyl]-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one (PubChem CID 86755964) has the molecular formula C17H16BrClF3NO2 and a molecular weight of 438.67 g/mol. Its IUPAC name is (3S,5S)-3-(2-bromoethyl)-7-chloro-5-[(E)-2-cyclopropylethenyl]-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one.
| Compound Name | (3S,5S)-3-(2-bromoethyl)-7-chloro-5-[(E)-2-cyclopropylethenyl]-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one |
|---|---|
| PubChem CID | 86755964 |
| Molecular Formula | C17H16BrClF3NO2 |
| Molecular Weight | 438.67 g/mol |
| Exact Mass | 437.00 |
| IUPAC Name | (3S,5S)-3-(2-bromoethyl)-7-chloro-5-[(E)-2-cyclopropylethenyl]-5-(trifluoromethyl)-1H-4,1-benzoxazepin-2-one |
| SMILES | O=C1Nc2ccc(Cl)cc2[C@@](/C=C/C2CC2)(C(F)(F)F)O[C@H]1CCBr |
| InChI | InChI=1S/C17H16BrClF3NO2/c18-8-6-14-15(24)23-13-4-3-11(19)9-12(13)16(25-14,17(20,21)22)7-5-10-1-2-10/h3-5,7,9-10,14H,1-2,6,8H2,(H,23,24)/b7-5+/t14-,16-/m0/s1 |
| InChIKey | MHVNWUVWYGJVKY-YOFOWSBGSA-N |
| XLogP | 5.19 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.67 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|