C26H30N2O7 — CID 86757059
(E)-but-2-enedioic acid;4-[3-(2-methoxyphenoxy)propyl]-3-piperidin-4-yl-1,2-benzoxazole (PubChem CID 86757059) has the molecular formula C26H30N2O7 and a molecular weight of 482.53 g/mol. Its IUPAC name is (E)-but-2-enedioic acid;4-[3-(2-methoxyphenoxy)propyl]-3-piperidin-4-yl-1,2-benzoxazole.
| Compound Name | (E)-but-2-enedioic acid;4-[3-(2-methoxyphenoxy)propyl]-3-piperidin-4-yl-1,2-benzoxazole |
|---|---|
| PubChem CID | 86757059 |
| Molecular Formula | C26H30N2O7 |
| Molecular Weight | 482.53 g/mol |
| Exact Mass | 482.21 |
| IUPAC Name | (E)-but-2-enedioic acid;4-[3-(2-methoxyphenoxy)propyl]-3-piperidin-4-yl-1,2-benzoxazole |
| SMILES | COc1ccccc1OCCCc1cccc2onc(C3CCNCC3)c12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C22H26N2O3.C4H4O4/c1-25-18-8-2-3-9-19(18)26-15-5-7-16-6-4-10-20-21(16)22(24-27-20)17-11-13-23-14-12-17;5-3(6)1-2-4(7)8/h2-4,6,8-10,17,23H,5,7,11-15H2,1H3;1-2H,(H,5,6)(H,7,8)/b;2-1+ |
| InChIKey | XSJYVVFKRCKEFX-WLHGVMLRSA-N |
| XLogP | 4.03 |
| TPSA | 131.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.53 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|