C22H24BrFN2O3 — CID 70240142
3-[3-(4-bromo-2-methoxyphenoxy)propyl]-6-fluoro-4-piperidin-4-yl-1,2-benzoxazole (PubChem CID 70240142) has the molecular formula C22H24BrFN2O3 and a molecular weight of 463.35 g/mol. Its IUPAC name is 3-[3-(4-bromo-2-methoxyphenoxy)propyl]-6-fluoro-4-piperidin-4-yl-1,2-benzoxazole.
| Compound Name | 3-[3-(4-bromo-2-methoxyphenoxy)propyl]-6-fluoro-4-piperidin-4-yl-1,2-benzoxazole |
|---|---|
| PubChem CID | 70240142 |
| Molecular Formula | C22H24BrFN2O3 |
| Molecular Weight | 463.35 g/mol |
| Exact Mass | 462.10 |
| IUPAC Name | 3-[3-(4-bromo-2-methoxyphenoxy)propyl]-6-fluoro-4-piperidin-4-yl-1,2-benzoxazole |
| SMILES | COc1cc(Br)ccc1OCCCc1noc2cc(F)cc(C3CCNCC3)c12 |
| InChI | InChI=1S/C22H24BrFN2O3/c1-27-20-11-15(23)4-5-19(20)28-10-2-3-18-22-17(14-6-8-25-9-7-14)12-16(24)13-21(22)29-26-18/h4-5,11-14,25H,2-3,6-10H2,1H3 |
| InChIKey | CPCDJROGUHGBIH-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.35 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|