About 2-ethoxyoct-7-ynal
2-ethoxyoct-7-ynal (PubChem CID 86757620) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-ethoxyoct-7-ynal.
Molecular Properties
| Compound Name | 2-ethoxyoct-7-ynal |
| PubChem CID | 86757620 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-ethoxyoct-7-ynal |
| SMILES | C#CCCCCC(C=O)OCC |
| InChI | InChI=1S/C10H16O2/c1-3-5-6-7-8-10(9-11)12-4-2/h1,9-10H,4-8H2,2H3 |
| InChIKey | VUHGHNDGAOCPNP-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyoct-7-ynal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyoct-7-ynal?
The IUPAC name of 2-ethoxyoct-7-ynal (CID 86757620) is 2-ethoxyoct-7-ynal.
What is the SMILES notation for 2-ethoxyoct-7-ynal?
The canonical SMILES for 2-ethoxyoct-7-ynal is C#CCCCCC(C=O)OCC.
What is the InChIKey of 2-ethoxyoct-7-ynal?
The InChIKey is VUHGHNDGAOCPNP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-3-5-6-7-8-10(9-11)12-4-2/h1,9-10H,4-8H2,2H3.
What are the key properties of 2-ethoxyoct-7-ynal?
2-ethoxyoct-7-ynal has a molecular weight of 168.24 g/mol, XLogP of 1.78, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyoct-7-ynal is sourced from PubChem (CID 86757620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).