C28H28N2O — CID 86758576
N-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]tricyclo[9.4.0.03,8]pentadeca-1(15),2,4,6,8,10,13-heptaene-2-carboxamide (PubChem CID 86758576) has the molecular formula C28H28N2O and a molecular weight of 408.55 g/mol. Its IUPAC name is N-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]tricyclo[9.4.0.03,8]pentadeca-1(15),2,4,6,8,10,13-heptaene-2-carboxamide.
| Compound Name | N-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]tricyclo[9.4.0.03,8]pentadeca-1(15),2,4,6,8,10,13-heptaene-2-carboxamide |
|---|---|
| PubChem CID | 86758576 |
| Molecular Formula | C28H28N2O |
| Molecular Weight | 408.55 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | N-[(3S)-1-(2-phenylethyl)pyrrolidin-3-yl]tricyclo[9.4.0.03,8]pentadeca-1(15),2,4,6,8,10,13-heptaene-2-carboxamide |
| SMILES | O=C(N[C@H]1CCN(CCc2ccccc2)C1)C1=c2ccccc2=CC=C2CC=CC=C21 |
| InChI | InChI=1S/C28H28N2O/c31-28(29-24-17-19-30(20-24)18-16-21-8-2-1-3-9-21)27-25-12-6-4-10-22(25)14-15-23-11-5-7-13-26(23)27/h1-10,12-15,24H,11,16-20H2,(H,29,31)/t24-/m0/s1 |
| InChIKey | SJCHONLJCNFWEF-DEOSSOPVSA-N |
| XLogP | 2.88 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |