C21H25N5O5S — CID 86758801
N-[4-[4-(aminomethyl)piperidin-1-yl]sulfonylphenyl]-1H-indazole-3-carboxamide;formic acid (PubChem CID 86758801) has the molecular formula C21H25N5O5S and a molecular weight of 459.53 g/mol. Its IUPAC name is N-[4-[4-(aminomethyl)piperidin-1-yl]sulfonylphenyl]-1H-indazole-3-carboxamide;formic acid.
| Compound Name | N-[4-[4-(aminomethyl)piperidin-1-yl]sulfonylphenyl]-1H-indazole-3-carboxamide;formic acid |
|---|---|
| PubChem CID | 86758801 |
| Molecular Formula | C21H25N5O5S |
| Molecular Weight | 459.53 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | N-[4-[4-(aminomethyl)piperidin-1-yl]sulfonylphenyl]-1H-indazole-3-carboxamide;formic acid |
| SMILES | NCC1CCN(S(=O)(=O)c2ccc(NC(=O)c3n[nH]c4ccccc34)cc2)CC1.O=CO |
| InChI | InChI=1S/C20H23N5O3S.CH2O2/c21-13-14-9-11-25(12-10-14)29(27,28)16-7-5-15(6-8-16)22-20(26)19-17-3-1-2-4-18(17)23-24-19;2-1-3/h1-8,14H,9-13,21H2,(H,22,26)(H,23,24);1H,(H,2,3) |
| InChIKey | VRESRJBHFSWMIM-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 158.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.53 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|