About dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride
dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride (PubChem CID 86760082) has the molecular formula C10H20ClNO
and a molecular weight of 205.73 g/mol. Its IUPAC name is dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride.
Molecular Properties
| Compound Name | dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride |
| PubChem CID | 86760082 |
| Molecular Formula | C10H20ClNO |
| Molecular Weight | 205.73 g/mol |
| Exact Mass | 205.12 |
| IUPAC Name | dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride |
| SMILES | C=CC[N+](C)(C)CC=C.C=CO.[Cl-] |
| InChI | InChI=1S/C8H16N.C2H4O.ClH/c1-5-7-9(3,4)8-6-2;1-2-3;/h5-6H,1-2,7-8H2,3-4H3;2-3H,1H2;1H/q+1;;/p-1 |
| InChIKey | IKYKUXAWPJQFFW-UHFFFAOYSA-M |
| XLogP | -0.87 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.73 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride?
The IUPAC name of dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride (CID 86760082) is dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride.
What is the SMILES notation for dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride?
The canonical SMILES for dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride is C=CC[N+](C)(C)CC=C.C=CO.[Cl-].
What is the InChIKey of dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride?
The InChIKey is IKYKUXAWPJQFFW-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H16N.C2H4O.ClH/c1-5-7-9(3,4)8-6-2;1-2-3;/h5-6H,1-2,7-8H2,3-4H3;2-3H,1H2;1H/q+1;;/p-1.
What are the key properties of dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride?
dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride has a molecular weight of 205.73 g/mol, XLogP of -0.87, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dimethyl-bis(prop-2-enyl)azanium;ethenol;chloride is sourced from PubChem (CID 86760082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).