C16H19F3INO2 — CID 86760842
2,2,2-trifluoro-N-[2-(2-iodo-5-methoxyphenyl)ethyl]-N-(3-methylbut-2-enyl)acetamide (PubChem CID 86760842) has the molecular formula C16H19F3INO2 and a molecular weight of 441.23 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-[2-(2-iodo-5-methoxyphenyl)ethyl]-N-(3-methylbut-2-enyl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-[2-(2-iodo-5-methoxyphenyl)ethyl]-N-(3-methylbut-2-enyl)acetamide |
|---|---|
| PubChem CID | 86760842 |
| Molecular Formula | C16H19F3INO2 |
| Molecular Weight | 441.23 g/mol |
| Exact Mass | 441.04 |
| IUPAC Name | 2,2,2-trifluoro-N-[2-(2-iodo-5-methoxyphenyl)ethyl]-N-(3-methylbut-2-enyl)acetamide |
| SMILES | COc1ccc(I)c(CCN(CC=C(C)C)C(=O)C(F)(F)F)c1 |
| InChI | InChI=1S/C16H19F3INO2/c1-11(2)6-8-21(15(22)16(17,18)19)9-7-12-10-13(23-3)4-5-14(12)20/h4-6,10H,7-9H2,1-3H3 |
| InChIKey | FYEGBRIXPRSPFL-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.23 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|