C28H29NO3 — CID 68534392
N,N-bis[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide (PubChem CID 68534392) has the molecular formula C28H29NO3 and a molecular weight of 427.54 g/mol. Its IUPAC name is N,N-bis[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide.
| Compound Name | N,N-bis[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 68534392 |
| Molecular Formula | C28H29NO3 |
| Molecular Weight | 427.54 g/mol |
| Exact Mass | 427.21 |
| IUPAC Name | N,N-bis[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide |
| SMILES | COc1ccc2cccc(CCN(CCc3cccc4ccc(OC)cc34)C(C)=O)c2c1 |
| InChI | InChI=1S/C28H29NO3/c1-20(30)29(16-14-23-8-4-6-21-10-12-25(31-2)18-27(21)23)17-15-24-9-5-7-22-11-13-26(32-3)19-28(22)24/h4-13,18-19H,14-17H2,1-3H3 |
| InChIKey | FHMJYCOMJMSPND-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.54 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |