C19H26N2O4S — CID 71227478
N-(tert-butylsulfamoyl)-N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide (PubChem CID 71227478) has the molecular formula C19H26N2O4S and a molecular weight of 378.49 g/mol. Its IUPAC name is N-(tert-butylsulfamoyl)-N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide.
| Compound Name | N-(tert-butylsulfamoyl)-N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 71227478 |
| Molecular Formula | C19H26N2O4S |
| Molecular Weight | 378.49 g/mol |
| Exact Mass | 378.16 |
| IUPAC Name | N-(tert-butylsulfamoyl)-N-[2-(7-methoxynaphthalen-1-yl)ethyl]acetamide |
| SMILES | COc1ccc2cccc(CCN(C(C)=O)S(=O)(=O)NC(C)(C)C)c2c1 |
| InChI | InChI=1S/C19H26N2O4S/c1-14(22)21(26(23,24)20-19(2,3)4)12-11-16-8-6-7-15-9-10-17(25-5)13-18(15)16/h6-10,13,20H,11-12H2,1-5H3 |
| InChIKey | HQMSXPDJFANIPX-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |