About ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide
ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide (PubChem CID 177154324) has the molecular formula C19H25NO4
and a molecular weight of 331.41 g/mol. Its IUPAC name is ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide.
Molecular Properties
| Compound Name | ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide |
| PubChem CID | 177154324 |
| Molecular Formula | C19H25NO4 |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.18 |
| IUPAC Name | ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide |
| SMILES | C=COCO.COc1ccc2cccc(CCN(C)C(C)=O)c2c1 |
| InChI | InChI=1S/C16H19NO2.C3H6O2/c1-12(18)17(2)10-9-14-6-4-5-13-7-8-15(19-3)11-16(13)14;1-2-5-3-4/h4-8,11H,9-10H2,1-3H3;2,4H,1,3H2 |
| InChIKey | GJNVCIWBBFUBDN-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide?
The IUPAC name of ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide (CID 177154324) is ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide.
What is the SMILES notation for ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide?
The canonical SMILES for ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide is C=COCO.COc1ccc2cccc(CCN(C)C(C)=O)c2c1.
What is the InChIKey of ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide?
The InChIKey is GJNVCIWBBFUBDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19NO2.C3H6O2/c1-12(18)17(2)10-9-14-6-4-5-13-7-8-15(19-3)11-16(13)14;1-2-5-3-4/h4-8,11H,9-10H2,1-3H3;2,4H,1,3H2.
What are the key properties of ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide?
ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide has a molecular weight of 331.41 g/mol, XLogP of 2.97, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethenoxymethanol;N-[2-(7-methoxynaphthalen-1-yl)ethyl]-N-methylacetamide is sourced from PubChem (CID 177154324), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).