C28H37NO3 — CID 71227579
N-acetyl-1-cyclohexyl-N-[2-(7-methoxynaphthalen-1-yl)ethyl]cyclohexane-1-carboxamide (PubChem CID 71227579) has the molecular formula C28H37NO3 and a molecular weight of 435.61 g/mol. Its IUPAC name is N-acetyl-1-cyclohexyl-N-[2-(7-methoxynaphthalen-1-yl)ethyl]cyclohexane-1-carboxamide.
| Compound Name | N-acetyl-1-cyclohexyl-N-[2-(7-methoxynaphthalen-1-yl)ethyl]cyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 71227579 |
| Molecular Formula | C28H37NO3 |
| Molecular Weight | 435.61 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | N-acetyl-1-cyclohexyl-N-[2-(7-methoxynaphthalen-1-yl)ethyl]cyclohexane-1-carboxamide |
| SMILES | COc1ccc2cccc(CCN(C(C)=O)C(=O)C3(C4CCCCC4)CCCCC3)c2c1 |
| InChI | InChI=1S/C28H37NO3/c1-21(30)29(19-16-23-11-9-10-22-14-15-25(32-2)20-26(22)23)27(31)28(17-7-4-8-18-28)24-12-5-3-6-13-24/h9-11,14-15,20,24H,3-8,12-13,16-19H2,1-2H3 |
| InChIKey | IVRSKURDXRGSEN-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.61 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |