C27H26Cl2FN5O3S — CID 86764338
(2S)-2-[[[2-(4-chlorophenyl)-3-(2-fluorophenyl)-3,4-dihydropyrazol-5-yl]-[(4-chlorophenyl)sulfonylamino]methylidene]amino]-3-methylbutanamide (PubChem CID 86764338) has the molecular formula C27H26Cl2FN5O3S and a molecular weight of 590.51 g/mol. Its IUPAC name is (2S)-2-[[[2-(4-chlorophenyl)-3-(2-fluorophenyl)-3,4-dihydropyrazol-5-yl]-[(4-chlorophenyl)sulfonylamino]methylidene]amino]-3-methylbutanamide.
| Compound Name | (2S)-2-[[[2-(4-chlorophenyl)-3-(2-fluorophenyl)-3,4-dihydropyrazol-5-yl]-[(4-chlorophenyl)sulfonylamino]methylidene]amino]-3-methylbutanamide |
|---|---|
| PubChem CID | 86764338 |
| Molecular Formula | C27H26Cl2FN5O3S |
| Molecular Weight | 590.51 g/mol |
| Exact Mass | 589.11 |
| IUPAC Name | (2S)-2-[[[2-(4-chlorophenyl)-3-(2-fluorophenyl)-3,4-dihydropyrazol-5-yl]-[(4-chlorophenyl)sulfonylamino]methylidene]amino]-3-methylbutanamide |
| SMILES | CC(C)[C@H](/N=C(/NS(=O)(=O)c1ccc(Cl)cc1)C1=NN(c2ccc(Cl)cc2)C(c2ccccc2F)C1)C(N)=O |
| InChI | InChI=1S/C27H26Cl2FN5O3S/c1-16(2)25(26(31)36)32-27(34-39(37,38)20-13-9-18(29)10-14-20)23-15-24(21-5-3-4-6-22(21)30)35(33-23)19-11-7-17(28)8-12-19/h3-14,16,24-25H,15H2,1-2H3,(H2,31,36)(H,32,34)/t24?,25-/m0/s1 |
| InChIKey | IWIRMNAHPSMLNT-BBMPLOMVSA-N |
| XLogP | 5.33 |
| TPSA | 117.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|