C25H24Cl2N4O2S2 — CID 123544776
2-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-(2-methylsulfanylethyl)-3-phenyl-3,4-dihydropyrazole-5-carboximidamide (PubChem CID 123544776) has the molecular formula C25H24Cl2N4O2S2 and a molecular weight of 547.53 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-(2-methylsulfanylethyl)-3-phenyl-3,4-dihydropyrazole-5-carboximidamide.
| Compound Name | 2-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-(2-methylsulfanylethyl)-3-phenyl-3,4-dihydropyrazole-5-carboximidamide |
|---|---|
| PubChem CID | 123544776 |
| Molecular Formula | C25H24Cl2N4O2S2 |
| Molecular Weight | 547.53 g/mol |
| Exact Mass | 546.07 |
| IUPAC Name | 2-(4-chlorophenyl)-N-(4-chlorophenyl)sulfonyl-N'-(2-methylsulfanylethyl)-3-phenyl-3,4-dihydropyrazole-5-carboximidamide |
| SMILES | CSCC/N=C(/NS(=O)(=O)c1ccc(Cl)cc1)C1=NN(c2ccc(Cl)cc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C25H24Cl2N4O2S2/c1-34-16-15-28-25(30-35(32,33)22-13-9-20(27)10-14-22)23-17-24(18-5-3-2-4-6-18)31(29-23)21-11-7-19(26)8-12-21/h2-14,24H,15-17H2,1H3,(H,28,30) |
| InChIKey | SEEMSUJNFLWJDG-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 74.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.53 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|