C28H24ClN5O2S2 — CID 123837474
methyl N'-[C-[2-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazol-5-yl]-N-naphthalen-2-ylsulfonylcarbonimidoyl]carbamimidothioate (PubChem CID 123837474) has the molecular formula C28H24ClN5O2S2 and a molecular weight of 562.12 g/mol. Its IUPAC name is methyl N'-[C-[2-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazol-5-yl]-N-naphthalen-2-ylsulfonylcarbonimidoyl]carbamimidothioate.
| Compound Name | methyl N'-[C-[2-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazol-5-yl]-N-naphthalen-2-ylsulfonylcarbonimidoyl]carbamimidothioate |
|---|---|
| PubChem CID | 123837474 |
| Molecular Formula | C28H24ClN5O2S2 |
| Molecular Weight | 562.12 g/mol |
| Exact Mass | 561.11 |
| IUPAC Name | methyl N'-[C-[2-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazol-5-yl]-N-naphthalen-2-ylsulfonylcarbonimidoyl]carbamimidothioate |
| SMILES | CS/C(N)=N\C(=NS(=O)(=O)c1ccc2ccccc2c1)C1=NN(c2ccc(Cl)cc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C28H24ClN5O2S2/c1-37-28(30)31-27(33-38(35,36)24-16-11-19-7-5-6-10-21(19)17-24)25-18-26(20-8-3-2-4-9-20)34(32-25)23-14-12-22(29)13-15-23/h2-17,26H,18H2,1H3,(H2,30,31,33) |
| InChIKey | YGFZIXSWZNBMIH-UHFFFAOYSA-N |
| XLogP | 6.27 |
| TPSA | 100.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.12 |
| LogP ≤ 5 | 6.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|