C16H16Cl2N4 — CID 68690910
2-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazole-5-carboximidamide;hydrochloride (PubChem CID 68690910) has the molecular formula C16H16Cl2N4 and a molecular weight of 335.24 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazole-5-carboximidamide;hydrochloride.
| Compound Name | 2-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazole-5-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 68690910 |
| Molecular Formula | C16H16Cl2N4 |
| Molecular Weight | 335.24 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-(4-chlorophenyl)-3-phenyl-3,4-dihydropyrazole-5-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)C1=NN(c2ccc(Cl)cc2)C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H15ClN4.ClH/c17-12-6-8-13(9-7-12)21-15(10-14(20-21)16(18)19)11-4-2-1-3-5-11;/h1-9,15H,10H2,(H3,18,19);1H |
| InChIKey | FGRMYBAHQVAXAW-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 65.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.24 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|