C19H22ClFN2O3S — CID 86765168
(2R)-2-[(4-chlorophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]-4-methylpentanamide (PubChem CID 86765168) has the molecular formula C19H22ClFN2O3S and a molecular weight of 412.91 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]-4-methylpentanamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 86765168 |
| Molecular Formula | C19H22ClFN2O3S |
| Molecular Weight | 412.91 g/mol |
| Exact Mass | 412.10 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)sulfonyl-[(2-fluorophenyl)methyl]amino]-4-methylpentanamide |
| SMILES | CC(C)C[C@H](C(N)=O)N(Cc1ccccc1F)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H22ClFN2O3S/c1-13(2)11-18(19(22)24)23(12-14-5-3-4-6-17(14)21)27(25,26)16-9-7-15(20)8-10-16/h3-10,13,18H,11-12H2,1-2H3,(H2,22,24)/t18-/m1/s1 |
| InChIKey | DLTJQQLSEAJQHU-GOSISDBHSA-N |
| XLogP | 3.57 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.91 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |