C18H28BrClN2O3S — CID 67195389
(2R)-2-[4-bromohexyl-(4-chlorophenyl)sulfonylamino]-4-methylpentanamide (PubChem CID 67195389) has the molecular formula C18H28BrClN2O3S and a molecular weight of 467.86 g/mol. Its IUPAC name is (2R)-2-[4-bromohexyl-(4-chlorophenyl)sulfonylamino]-4-methylpentanamide.
| Compound Name | (2R)-2-[4-bromohexyl-(4-chlorophenyl)sulfonylamino]-4-methylpentanamide |
|---|---|
| PubChem CID | 67195389 |
| Molecular Formula | C18H28BrClN2O3S |
| Molecular Weight | 467.86 g/mol |
| Exact Mass | 466.07 |
| IUPAC Name | (2R)-2-[4-bromohexyl-(4-chlorophenyl)sulfonylamino]-4-methylpentanamide |
| SMILES | CCC(Br)CCCN([C@H](CC(C)C)C(N)=O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H28BrClN2O3S/c1-4-14(19)6-5-11-22(17(18(21)23)12-13(2)3)26(24,25)16-9-7-15(20)8-10-16/h7-10,13-14,17H,4-6,11-12H2,1-3H3,(H2,21,23)/t14?,17-/m1/s1 |
| InChIKey | URXLTWUNCFNTRM-FBMWCMRBSA-N |
| XLogP | 4.18 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.86 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|