C15H17ClF3N3O3S — CID 57384790
(2R)-2-[(4-chlorophenyl)sulfonyl-(3-cyanopropyl)amino]-5,5,5-trifluoropentanamide (PubChem CID 57384790) has the molecular formula C15H17ClF3N3O3S and a molecular weight of 411.83 g/mol. Its IUPAC name is (2R)-2-[(4-chlorophenyl)sulfonyl-(3-cyanopropyl)amino]-5,5,5-trifluoropentanamide.
| Compound Name | (2R)-2-[(4-chlorophenyl)sulfonyl-(3-cyanopropyl)amino]-5,5,5-trifluoropentanamide |
|---|---|
| PubChem CID | 57384790 |
| Molecular Formula | C15H17ClF3N3O3S |
| Molecular Weight | 411.83 g/mol |
| Exact Mass | 411.06 |
| IUPAC Name | (2R)-2-[(4-chlorophenyl)sulfonyl-(3-cyanopropyl)amino]-5,5,5-trifluoropentanamide |
| SMILES | N#CCCCN([C@H](CCC(F)(F)F)C(N)=O)S(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C15H17ClF3N3O3S/c16-11-3-5-12(6-4-11)26(24,25)22(10-2-1-9-20)13(14(21)23)7-8-15(17,18)19/h3-6,13H,1-2,7-8,10H2,(H2,21,23)/t13-/m1/s1 |
| InChIKey | HTXJBXCTEVMBLA-CYBMUJFWSA-N |
| XLogP | 2.83 |
| TPSA | 104.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.83 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|