C15H19ClFNO — CID 86771401
9-[(2-chloro-6-fluorophenyl)methyl]-6-oxa-9-azaspiro[3.6]decane (PubChem CID 86771401) has the molecular formula C15H19ClFNO and a molecular weight of 283.77 g/mol. Its IUPAC name is 9-[(2-chloro-6-fluorophenyl)methyl]-6-oxa-9-azaspiro[3.6]decane.
| Compound Name | 9-[(2-chloro-6-fluorophenyl)methyl]-6-oxa-9-azaspiro[3.6]decane |
|---|---|
| PubChem CID | 86771401 |
| Molecular Formula | C15H19ClFNO |
| Molecular Weight | 283.77 g/mol |
| Exact Mass | 283.11 |
| IUPAC Name | 9-[(2-chloro-6-fluorophenyl)methyl]-6-oxa-9-azaspiro[3.6]decane |
| SMILES | Fc1cccc(Cl)c1CN1CCOCC2(CCC2)C1 |
| InChI | InChI=1S/C15H19ClFNO/c16-13-3-1-4-14(17)12(13)9-18-7-8-19-11-15(10-18)5-2-6-15/h1,3-4H,2,5-11H2 |
| InChIKey | QAEVKICZSYUSRZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.77 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |