C29H35N3O3 — CID 86776107
(E)-1-[2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 86776107) has the molecular formula C29H35N3O3 and a molecular weight of 473.62 g/mol. Its IUPAC name is (E)-1-[2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 86776107 |
| Molecular Formula | C29H35N3O3 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.27 |
| IUPAC Name | (E)-1-[2-[4-(2-methoxyphenyl)piperazine-1-carbonyl]-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | COc1ccccc1N1CCN(C(=O)C2CC3CCCCC3N2C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C29H35N3O3/c1-35-27-14-8-7-13-25(27)30-17-19-31(20-18-30)29(34)26-21-23-11-5-6-12-24(23)32(26)28(33)16-15-22-9-3-2-4-10-22/h2-4,7-10,13-16,23-24,26H,5-6,11-12,17-21H2,1H3/b16-15+ |
| InChIKey | KJSWRXSAKVWKSA-FOCLMDBBSA-N |
| XLogP | 4.22 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|