C26H28N2O2 — CID 86776117
(E)-1-[2-(2,3-dihydroindole-1-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 86776117) has the molecular formula C26H28N2O2 and a molecular weight of 400.52 g/mol. Its IUPAC name is (E)-1-[2-(2,3-dihydroindole-1-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[2-(2,3-dihydroindole-1-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 86776117 |
| Molecular Formula | C26H28N2O2 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.22 |
| IUPAC Name | (E)-1-[2-(2,3-dihydroindole-1-carbonyl)-2,3,3a,4,5,6,7,7a-octahydroindol-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(C1CC2CCCCC2N1C(=O)/C=C/c1ccccc1)N1CCc2ccccc21 |
| InChI | InChI=1S/C26H28N2O2/c29-25(15-14-19-8-2-1-3-9-19)28-23-13-7-5-11-21(23)18-24(28)26(30)27-17-16-20-10-4-6-12-22(20)27/h1-4,6,8-10,12,14-15,21,23-24H,5,7,11,13,16-18H2/b15-14+ |
| InChIKey | DBQGXDCFSAKHND-CCEZHUSRSA-N |
| XLogP | 4.45 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|