C16H24N2O4 — CID 86776670
2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-(2-bicyclo[2.2.1]heptanyl)acetate (PubChem CID 86776670) has the molecular formula C16H24N2O4 and a molecular weight of 308.38 g/mol. Its IUPAC name is 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-(2-bicyclo[2.2.1]heptanyl)acetate.
| Compound Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-(2-bicyclo[2.2.1]heptanyl)acetate |
|---|---|
| PubChem CID | 86776670 |
| Molecular Formula | C16H24N2O4 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.17 |
| IUPAC Name | 2-(4,4-dimethyl-2,5-dioxoimidazolidin-1-yl)ethyl 2-(2-bicyclo[2.2.1]heptanyl)acetate |
| SMILES | CC1(C)NC(=O)N(CCOC(=O)CC2CC3CCC2C3)C1=O |
| InChI | InChI=1S/C16H24N2O4/c1-16(2)14(20)18(15(21)17-16)5-6-22-13(19)9-12-8-10-3-4-11(12)7-10/h10-12H,3-9H2,1-2H3,(H,17,21) |
| InChIKey | GWTMIMWGFZITEC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|