C13H28N4 — CID 86777122
1,2-dimethyl-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 86777122) has the molecular formula C13H28N4 and a molecular weight of 240.39 g/mol. Its IUPAC name is 1,2-dimethyl-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1,2-dimethyl-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 86777122 |
| Molecular Formula | C13H28N4 |
| Molecular Weight | 240.39 g/mol |
| Exact Mass | 240.23 |
| IUPAC Name | 1,2-dimethyl-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NC)NCC(C)(C)N1CCCC(C)C1 |
| InChI | InChI=1S/C13H28N4/c1-11-7-6-8-17(9-11)13(2,3)10-16-12(14-4)15-5/h11H,6-10H2,1-5H3,(H2,14,15,16) |
| InChIKey | CUNDGJYDZTXEEW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.39 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|