C16H33IN4O2S — CID 111140958
1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine;hydroiodide (PubChem CID 111140958) has the molecular formula C16H33IN4O2S and a molecular weight of 472.44 g/mol. Its IUPAC name is 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111140958 |
| Molecular Formula | C16H33IN4O2S |
| Molecular Weight | 472.44 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 1-(1,1-dioxothiolan-3-yl)-2-methyl-3-[2-methyl-2-(3-methylpiperidin-1-yl)propyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCC(C)(C)N1CCCC(C)C1)NC1CCS(=O)(=O)C1.I |
| InChI | InChI=1S/C16H32N4O2S.HI/c1-13-6-5-8-20(10-13)16(2,3)12-18-15(17-4)19-14-7-9-23(21,22)11-14;/h13-14H,5-12H2,1-4H3,(H2,17,18,19);1H |
| InChIKey | VOFJESFIBUPOLV-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|