C13H25NO3S2 — CID 86780939
4-tert-butylsulfanyl-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-1-one (PubChem CID 86780939) has the molecular formula C13H25NO3S2 and a molecular weight of 307.48 g/mol. Its IUPAC name is 4-tert-butylsulfanyl-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-1-one.
| Compound Name | 4-tert-butylsulfanyl-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-1-one |
|---|---|
| PubChem CID | 86780939 |
| Molecular Formula | C13H25NO3S2 |
| Molecular Weight | 307.48 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | 4-tert-butylsulfanyl-1-(3-methyl-1,1-dioxo-1,4-thiazinan-4-yl)butan-1-one |
| SMILES | CC1CS(=O)(=O)CCN1C(=O)CCCSC(C)(C)C |
| InChI | InChI=1S/C13H25NO3S2/c1-11-10-19(16,17)9-7-14(11)12(15)6-5-8-18-13(2,3)4/h11H,5-10H2,1-4H3 |
| InChIKey | IPIUSUXUBOAPIU-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|