C17H24N4O2S — CID 86781119
1-ethyl-2-[(4-methylsulfonylphenyl)methyl]-3-(2-pyrrol-1-ylethyl)guanidine (PubChem CID 86781119) has the molecular formula C17H24N4O2S and a molecular weight of 348.47 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methylsulfonylphenyl)methyl]-3-(2-pyrrol-1-ylethyl)guanidine.
| Compound Name | 1-ethyl-2-[(4-methylsulfonylphenyl)methyl]-3-(2-pyrrol-1-ylethyl)guanidine |
|---|---|
| PubChem CID | 86781119 |
| Molecular Formula | C17H24N4O2S |
| Molecular Weight | 348.47 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | 1-ethyl-2-[(4-methylsulfonylphenyl)methyl]-3-(2-pyrrol-1-ylethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(S(C)(=O)=O)cc1)NCCn1cccc1 |
| InChI | InChI=1S/C17H24N4O2S/c1-3-18-17(19-10-13-21-11-4-5-12-21)20-14-15-6-8-16(9-7-15)24(2,22)23/h4-9,11-12H,3,10,13-14H2,1-2H3,(H2,18,19,20) |
| InChIKey | OJTWFJCSAVPTHC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 75.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.47 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|