C16H19N3OS — CID 86781542
3-(1H-indazol-7-ylmethylamino)-1-thiophen-2-ylbutan-1-ol (PubChem CID 86781542) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 3-(1H-indazol-7-ylmethylamino)-1-thiophen-2-ylbutan-1-ol.
| Compound Name | 3-(1H-indazol-7-ylmethylamino)-1-thiophen-2-ylbutan-1-ol |
|---|---|
| PubChem CID | 86781542 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 3-(1H-indazol-7-ylmethylamino)-1-thiophen-2-ylbutan-1-ol |
| SMILES | CC(CC(O)c1cccs1)NCc1cccc2cn[nH]c12 |
| InChI | InChI=1S/C16H19N3OS/c1-11(8-14(20)15-6-3-7-21-15)17-9-12-4-2-5-13-10-18-19-16(12)13/h2-7,10-11,14,17,20H,8-9H2,1H3,(H,18,19) |
| InChIKey | ULSPIENDXISLGZ-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 60.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |