C14H11ClFN3O — CID 86781943
5-[[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]pyridine-2-carbonitrile (PubChem CID 86781943) has the molecular formula C14H11ClFN3O and a molecular weight of 291.71 g/mol. Its IUPAC name is 5-[[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]pyridine-2-carbonitrile.
| Compound Name | 5-[[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]pyridine-2-carbonitrile |
|---|---|
| PubChem CID | 86781943 |
| Molecular Formula | C14H11ClFN3O |
| Molecular Weight | 291.71 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 5-[[1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]pyridine-2-carbonitrile |
| SMILES | N#Cc1ccc(NC(CO)c2ccc(Cl)c(F)c2)cn1 |
| InChI | InChI=1S/C14H11ClFN3O/c15-12-4-1-9(5-13(12)16)14(8-20)19-11-3-2-10(6-17)18-7-11/h1-5,7,14,19-20H,8H2 |
| InChIKey | OYMLJOJTJNAPAZ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.71 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |