C18H13ClFN3O — CID 97158817
2-[[(1R)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]quinoline-6-carbonitrile (PubChem CID 97158817) has the molecular formula C18H13ClFN3O and a molecular weight of 341.77 g/mol. Its IUPAC name is 2-[[(1R)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]quinoline-6-carbonitrile.
| Compound Name | 2-[[(1R)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]quinoline-6-carbonitrile |
|---|---|
| PubChem CID | 97158817 |
| Molecular Formula | C18H13ClFN3O |
| Molecular Weight | 341.77 g/mol |
| Exact Mass | 341.07 |
| IUPAC Name | 2-[[(1R)-1-(4-chloro-3-fluorophenyl)-2-hydroxyethyl]amino]quinoline-6-carbonitrile |
| SMILES | N#Cc1ccc2nc(N[C@@H](CO)c3ccc(Cl)c(F)c3)ccc2c1 |
| InChI | InChI=1S/C18H13ClFN3O/c19-14-4-2-13(8-15(14)20)17(10-24)23-18-6-3-12-7-11(9-21)1-5-16(12)22-18/h1-8,17,24H,10H2,(H,22,23)/t17-/m0/s1 |
| InChIKey | DFCKSTUITKHZCB-KRWDZBQOSA-N |
| XLogP | 4.04 |
| TPSA | 68.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.77 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |