About 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile
5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile (PubChem CID 86782075) has the molecular formula C14H15N5O
and a molecular weight of 269.31 g/mol. Its IUPAC name is 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile.
Molecular Properties
| Compound Name | 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile |
| PubChem CID | 86782075 |
| Molecular Formula | C14H15N5O |
| Molecular Weight | 269.31 g/mol |
| Exact Mass | 269.13 |
| IUPAC Name | 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile |
| SMILES | Cc1noc(C2CCN(c3ccc(C#N)nc3)CC2)n1 |
| InChI | InChI=1S/C14H15N5O/c1-10-17-14(20-18-10)11-4-6-19(7-5-11)13-3-2-12(8-15)16-9-13/h2-3,9,11H,4-7H2,1H3 |
| InChIKey | KDRFISLQVLMUDT-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 78.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.31 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile?
The IUPAC name of 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile (CID 86782075) is 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile.
What is the SMILES notation for 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile?
The canonical SMILES for 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile is Cc1noc(C2CCN(c3ccc(C#N)nc3)CC2)n1.
What is the InChIKey of 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile?
The InChIKey is KDRFISLQVLMUDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H15N5O/c1-10-17-14(20-18-10)11-4-6-19(7-5-11)13-3-2-12(8-15)16-9-13/h2-3,9,11H,4-7H2,1H3.
What are the key properties of 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile?
5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile has a molecular weight of 269.31 g/mol, XLogP of 2.03, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[4-(3-methyl-1,2,4-oxadiazol-5-yl)piperidin-1-yl]pyridine-2-carbonitrile is sourced from PubChem (CID 86782075), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).