C19H27NO2 — CID 86782266
N-[(4-methoxyphenyl)-(oxan-4-yl)methyl]cyclohex-2-en-1-amine (PubChem CID 86782266) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is N-[(4-methoxyphenyl)-(oxan-4-yl)methyl]cyclohex-2-en-1-amine.
| Compound Name | N-[(4-methoxyphenyl)-(oxan-4-yl)methyl]cyclohex-2-en-1-amine |
|---|---|
| PubChem CID | 86782266 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | N-[(4-methoxyphenyl)-(oxan-4-yl)methyl]cyclohex-2-en-1-amine |
| SMILES | COc1ccc(C(NC2C=CCCC2)C2CCOCC2)cc1 |
| InChI | InChI=1S/C19H27NO2/c1-21-18-9-7-15(8-10-18)19(16-11-13-22-14-12-16)20-17-5-3-2-4-6-17/h3,5,7-10,16-17,19-20H,2,4,6,11-14H2,1H3 |
| InChIKey | USFZEQPIOOKLGJ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|