C14H19NO2 — CID 107906285
N-cyclohex-2-en-1-yl-2,4-dimethoxyaniline (PubChem CID 107906285) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is N-cyclohex-2-en-1-yl-2,4-dimethoxyaniline.
| Compound Name | N-cyclohex-2-en-1-yl-2,4-dimethoxyaniline |
|---|---|
| PubChem CID | 107906285 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | N-cyclohex-2-en-1-yl-2,4-dimethoxyaniline |
| SMILES | COc1ccc(NC2C=CCCC2)c(OC)c1 |
| InChI | InChI=1S/C14H19NO2/c1-16-12-8-9-13(14(10-12)17-2)15-11-6-4-3-5-7-11/h4,6,8-11,15H,3,5,7H2,1-2H3 |
| InChIKey | TVNRYXDJKCOHNZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|