C13H11ClF2N2OS — CID 86783345
3-chloro-2,4-difluoro-N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide (PubChem CID 86783345) has the molecular formula C13H11ClF2N2OS and a molecular weight of 316.76 g/mol. Its IUPAC name is 3-chloro-2,4-difluoro-N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide.
| Compound Name | 3-chloro-2,4-difluoro-N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide |
|---|---|
| PubChem CID | 86783345 |
| Molecular Formula | C13H11ClF2N2OS |
| Molecular Weight | 316.76 g/mol |
| Exact Mass | 316.02 |
| IUPAC Name | 3-chloro-2,4-difluoro-N-methyl-N-[(4-methyl-1,3-thiazol-2-yl)methyl]benzamide |
| SMILES | Cc1csc(CN(C)C(=O)c2ccc(F)c(Cl)c2F)n1 |
| InChI | InChI=1S/C13H11ClF2N2OS/c1-7-6-20-10(17-7)5-18(2)13(19)8-3-4-9(15)11(14)12(8)16/h3-4,6H,5H2,1-2H3 |
| InChIKey | CJQLQPPIDXHYHS-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.76 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|