C17H16F2N2O3 — CID 86786273
4-(2,4-difluorophenyl)-N-(3-hydroxy-4-pyridinyl)oxane-4-carboxamide (PubChem CID 86786273) has the molecular formula C17H16F2N2O3 and a molecular weight of 334.32 g/mol. Its IUPAC name is 4-(2,4-difluorophenyl)-N-(3-hydroxy-4-pyridinyl)oxane-4-carboxamide.
| Compound Name | 4-(2,4-difluorophenyl)-N-(3-hydroxy-4-pyridinyl)oxane-4-carboxamide |
|---|---|
| PubChem CID | 86786273 |
| Molecular Formula | C17H16F2N2O3 |
| Molecular Weight | 334.32 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 4-(2,4-difluorophenyl)-N-(3-hydroxy-4-pyridinyl)oxane-4-carboxamide |
| SMILES | O=C(Nc1ccncc1O)C1(c2ccc(F)cc2F)CCOCC1 |
| InChI | InChI=1S/C17H16F2N2O3/c18-11-1-2-12(13(19)9-11)17(4-7-24-8-5-17)16(23)21-14-3-6-20-10-15(14)22/h1-3,6,9-10,22H,4-5,7-8H2,(H,20,21,23) |
| InChIKey | AZINVGPZDTVYTF-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |