C14H14FN3O2S — CID 86788063
N-[4-[(2-acetyl-5-fluoroanilino)methyl]-1,3-thiazol-2-yl]acetamide (PubChem CID 86788063) has the molecular formula C14H14FN3O2S and a molecular weight of 307.35 g/mol. Its IUPAC name is N-[4-[(2-acetyl-5-fluoroanilino)methyl]-1,3-thiazol-2-yl]acetamide.
| Compound Name | N-[4-[(2-acetyl-5-fluoroanilino)methyl]-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 86788063 |
| Molecular Formula | C14H14FN3O2S |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-[4-[(2-acetyl-5-fluoroanilino)methyl]-1,3-thiazol-2-yl]acetamide |
| SMILES | CC(=O)Nc1nc(CNc2cc(F)ccc2C(C)=O)cs1 |
| InChI | InChI=1S/C14H14FN3O2S/c1-8(19)12-4-3-10(15)5-13(12)16-6-11-7-21-14(18-11)17-9(2)20/h3-5,7,16H,6H2,1-2H3,(H,17,18,20) |
| InChIKey | NYQYDJJHDICIQH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |