C14H16BrN3O2 — CID 86788484
N-(4-bromo-2-hydroxyphenyl)-2-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide (PubChem CID 86788484) has the molecular formula C14H16BrN3O2 and a molecular weight of 338.21 g/mol. Its IUPAC name is N-(4-bromo-2-hydroxyphenyl)-2-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide.
| Compound Name | N-(4-bromo-2-hydroxyphenyl)-2-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide |
|---|---|
| PubChem CID | 86788484 |
| Molecular Formula | C14H16BrN3O2 |
| Molecular Weight | 338.21 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | N-(4-bromo-2-hydroxyphenyl)-2-(3,5-dimethyl-1H-pyrazol-4-yl)propanamide |
| SMILES | Cc1n[nH]c(C)c1C(C)C(=O)Nc1ccc(Br)cc1O |
| InChI | InChI=1S/C14H16BrN3O2/c1-7(13-8(2)17-18-9(13)3)14(20)16-11-5-4-10(15)6-12(11)19/h4-7,19H,1-3H3,(H,16,20)(H,17,18) |
| InChIKey | AVYLLBLKFRRWFN-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 78.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|