C14H15N7O4 — CID 86790496
1-ethyl-3-methyl-N-[5-(5-methylfuran-2-yl)-1H-1,2,4-triazol-3-yl]-4-nitropyrazole-5-carboxamide (PubChem CID 86790496) has the molecular formula C14H15N7O4 and a molecular weight of 345.32 g/mol. Its IUPAC name is 1-ethyl-3-methyl-N-[5-(5-methylfuran-2-yl)-1H-1,2,4-triazol-3-yl]-4-nitropyrazole-5-carboxamide.
| Compound Name | 1-ethyl-3-methyl-N-[5-(5-methylfuran-2-yl)-1H-1,2,4-triazol-3-yl]-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 86790496 |
| Molecular Formula | C14H15N7O4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | 1-ethyl-3-methyl-N-[5-(5-methylfuran-2-yl)-1H-1,2,4-triazol-3-yl]-4-nitropyrazole-5-carboxamide |
| SMILES | CCn1nc(C)c([N+](=O)[O-])c1C(=O)Nc1n[nH]c(-c2ccc(C)o2)n1 |
| InChI | InChI=1S/C14H15N7O4/c1-4-20-11(10(21(23)24)8(3)19-20)13(22)16-14-15-12(17-18-14)9-6-5-7(2)25-9/h5-6H,4H2,1-3H3,(H2,15,16,17,18,22) |
| InChIKey | QZCRMOPSGWLLLQ-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 144.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|