C18H17F2N5O4S — CID 75400777
N-[4-[4-(difluoromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-1-ethyl-3-methyl-4-nitropyrazole-5-carboxamide (PubChem CID 75400777) has the molecular formula C18H17F2N5O4S and a molecular weight of 437.43 g/mol. Its IUPAC name is N-[4-[4-(difluoromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-1-ethyl-3-methyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[4-[4-(difluoromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-1-ethyl-3-methyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 75400777 |
| Molecular Formula | C18H17F2N5O4S |
| Molecular Weight | 437.43 g/mol |
| Exact Mass | 437.10 |
| IUPAC Name | N-[4-[4-(difluoromethoxy)phenyl]-5-methyl-1,3-thiazol-2-yl]-1-ethyl-3-methyl-4-nitropyrazole-5-carboxamide |
| SMILES | CCn1nc(C)c([N+](=O)[O-])c1C(=O)Nc1nc(-c2ccc(OC(F)F)cc2)c(C)s1 |
| InChI | InChI=1S/C18H17F2N5O4S/c1-4-24-15(14(25(27)28)9(2)23-24)16(26)22-18-21-13(10(3)30-18)11-5-7-12(8-6-11)29-17(19)20/h5-8,17H,4H2,1-3H3,(H,21,22,26) |
| InChIKey | IFIBAGBTFQWAHH-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|