C15H13F2N5O4S — CID 19515829
N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide (PubChem CID 19515829) has the molecular formula C15H13F2N5O4S and a molecular weight of 397.36 g/mol. Its IUPAC name is N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide.
| Compound Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19515829 |
| Molecular Formula | C15H13F2N5O4S |
| Molecular Weight | 397.36 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetamide |
| SMILES | Cc1nn(CC(=O)Nc2nc3ccc(OC(F)F)cc3s2)c(C)c1[N+](=O)[O-] |
| InChI | InChI=1S/C15H13F2N5O4S/c1-7-13(22(24)25)8(2)21(20-7)6-12(23)19-15-18-10-4-3-9(26-14(16)17)5-11(10)27-15/h3-5,14H,6H2,1-2H3,(H,18,19,23) |
| InChIKey | FBMIQOXKYCXLBT-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.36 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|