C14H12ClN5O3S — CID 19529358
2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)acetamide (PubChem CID 19529358) has the molecular formula C14H12ClN5O3S and a molecular weight of 365.80 g/mol. Its IUPAC name is 2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | 2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 19529358 |
| Molecular Formula | C14H12ClN5O3S |
| Molecular Weight | 365.80 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)-N-(6-methyl-1,3-benzothiazol-2-yl)acetamide |
| SMILES | Cc1ccc2nc(NC(=O)Cn3nc([N+](=O)[O-])c(Cl)c3C)sc2c1 |
| InChI | InChI=1S/C14H12ClN5O3S/c1-7-3-4-9-10(5-7)24-14(16-9)17-11(21)6-19-8(2)12(15)13(18-19)20(22)23/h3-5H,6H2,1-2H3,(H,16,17,21) |
| InChIKey | BNUBKPZAQKCNHI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 102.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|