C14H10F2N6O6S — CID 19530051
N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide (PubChem CID 19530051) has the molecular formula C14H10F2N6O6S and a molecular weight of 428.33 g/mol. Its IUPAC name is N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide.
| Compound Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
|---|---|
| PubChem CID | 19530051 |
| Molecular Formula | C14H10F2N6O6S |
| Molecular Weight | 428.33 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-2-(5-methyl-3,4-dinitropyrazol-1-yl)acetamide |
| SMILES | Cc1c([N+](=O)[O-])c([N+](=O)[O-])nn1CC(=O)Nc1nc2ccc(OC(F)F)cc2s1 |
| InChI | InChI=1S/C14H10F2N6O6S/c1-6-11(21(24)25)12(22(26)27)19-20(6)5-10(23)18-14-17-8-3-2-7(28-13(15)16)4-9(8)29-14/h2-4,13H,5H2,1H3,(H,17,18,23) |
| InChIKey | CIEAUYMERAVEGF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 155.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|