C14H11F2N5O4S — CID 19476515
N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-1-ethyl-4-nitropyrazole-5-carboxamide (PubChem CID 19476515) has the molecular formula C14H11F2N5O4S and a molecular weight of 383.34 g/mol. Its IUPAC name is N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-1-ethyl-4-nitropyrazole-5-carboxamide.
| Compound Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-1-ethyl-4-nitropyrazole-5-carboxamide |
|---|---|
| PubChem CID | 19476515 |
| Molecular Formula | C14H11F2N5O4S |
| Molecular Weight | 383.34 g/mol |
| Exact Mass | 383.05 |
| IUPAC Name | N-[6-(difluoromethoxy)-1,3-benzothiazol-2-yl]-1-ethyl-4-nitropyrazole-5-carboxamide |
| SMILES | CCn1ncc([N+](=O)[O-])c1C(=O)Nc1nc2ccc(OC(F)F)cc2s1 |
| InChI | InChI=1S/C14H11F2N5O4S/c1-2-20-11(9(6-17-20)21(23)24)12(22)19-14-18-8-4-3-7(25-13(15)16)5-10(8)26-14/h3-6,13H,2H2,1H3,(H,18,19,22) |
| InChIKey | JUVFYKOSOBRCPM-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 112.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.34 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|